|
|
| | 2-Acetyl-4-butyramidophenol Basic information |
| | 2-Acetyl-4-butyramidophenol Chemical Properties |
| Melting point | 120-126 °C (lit.) | | Boiling point | 428.0±35.0 °C(Predicted) | | density | 1.192±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | solid | | pka | 10.37±0.31(Predicted) | | color | Pale Beige | | InChI | InChI=1S/C12H15NO3/c1-3-4-12(16)13-9-5-6-11(15)10(7-9)8(2)14/h5-7,15H,3-4H2,1-2H3,(H,13,16) | | InChIKey | FGWZEOPEZISTTR-UHFFFAOYSA-N | | SMILES | C(NC1=CC=C(O)C(C(C)=O)=C1)(=O)CCC | | CAS DataBase Reference | 40188-45-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 38 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Acetyl-4-butyramidophenol Usage And Synthesis |
| | 2-Acetyl-4-butyramidophenol Preparation Products And Raw materials |
|