| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 4-Oxo Ticlopidine Basic information |
| | 4-Oxo Ticlopidine Chemical Properties |
| Boiling point | 464.5±45.0 °C(Predicted) | | density | 1.364±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -1.60±0.20(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C14H12ClNOS/c15-12-4-2-1-3-10(12)9-16-7-5-13-11(14(16)17)6-8-18-13/h1-4,6,8H,5,7,9H2 | | InChIKey | KQQBLQBNIVSMLU-UHFFFAOYSA-N | | SMILES | [s]1c2c(cc1)C(=O)N(CC2)Cc3c(cccc3)Cl |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| | 4-Oxo Ticlopidine Usage And Synthesis |
| Uses | A metabolite of Ticlopidine (T438325). |
| | 4-Oxo Ticlopidine Preparation Products And Raw materials |
|