|
|
| | TICLOPIDINE IMPURITY F Basic information |
| Product Name: | TICLOPIDINE IMPURITY F | | Synonyms: | TICLOPIDINE IMPURITY F;6-(2-Chlorobenzyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine;Ticlopidine Impurity 6(Ticlopidine EP Impurity F);6-[(2-chlorophenyl)methyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine;Ticlopidine EP Impurity F;Ticlodipine EP Impurity F;Thieno[2,3-c]pyridine, 6-[(2-chlorophenyl)methyl]-4,5,6,7-tetrahydro-;Ticlopidine hydrochloride EP Impurity F | | CAS: | 62019-75-4 | | MF: | C14H14ClNS | | MW: | 263.79 | | EINECS: | | | Product Categories: | | | Mol File: | 62019-75-4.mol |  |
| | TICLOPIDINE IMPURITY F Chemical Properties |
| Boiling point | 367.3±37.0 °C(Predicted) | | density | 1.273±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 6.56±0.20(Predicted) | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C14H14ClNS/c15-13-4-2-1-3-12(13)9-16-7-5-11-6-8-17-14(11)10-16/h1-4,6,8H,5,7,9-10H2 | | InChIKey | HPUZXEAFETYUCC-UHFFFAOYSA-N | | SMILES | [s]1c2c(cc1)CCN(C2)Cc3c(cccc3)Cl |
| | TICLOPIDINE IMPURITY F Usage And Synthesis |
| Uses | Ticlopidine impurity F EP Reference standard, intended for use in laboratory tests only as specifically prescribed in the European Pharmacopoeia. |
| | TICLOPIDINE IMPURITY F Preparation Products And Raw materials |
|