|
|
| | 6.7-dihydrothieno[3.2.c]pyridin-4(5H)-one Basic information |
| Product Name: | 6.7-dihydrothieno[3.2.c]pyridin-4(5H)-one | | Synonyms: | 6.7-dihydrothieno[3.2.c]pyridin-4(5H)-one;Ticlopidine Impurity 2(Ticlopidine EP Impurity B);6,7-dihydro-5H-thieno[3,2-c]pyridin-4-one;Ticlopidine Related Compound A (20 mg) (4-oxo-4,5,6,7-tetrahydrothieno-[3,2-c]pyridine);Ticlopidine Related CoMpound A;Thieno[3,2-c]pyridin-4(5H)-one, 6,7-dihydro-;6,7-Dihydrothieno[3,2-c]-pyridin-4(;Ticlopidine EP Impurity B | | CAS: | 68559-60-4 | | MF: | C7H7NOS | | MW: | 153.2 | | EINECS: | | | Product Categories: | | | Mol File: | 68559-60-4.mol | ![6.7-dihydrothieno[3.2.c]pyridin-4(5H)-one Structure](CAS/20150408/GIF/68559-60-4.gif) |
| | 6.7-dihydrothieno[3.2.c]pyridin-4(5H)-one Chemical Properties |
| Boiling point | 417.1±34.0 °C(Predicted) | | density | 1.295±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 14.35±0.20(Predicted) | | Appearance | Yellow to brown Solid | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C7H7NOS/c9-7-5-2-4-10-6(5)1-3-8-7/h2,4H,1,3H2,(H,8,9) | | InChIKey | SFNZVNVCJWVPDM-UHFFFAOYSA-N | | SMILES | C1(=O)NCCC2SC=CC1=2 |
| WGK Germany | WGK 1 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| | 6.7-dihydrothieno[3.2.c]pyridin-4(5H)-one Usage And Synthesis |
| Uses | 4-Oxo-4,5,6,7-tetrahydrothieno-[3,2-c]pyridine is an impurity in the preparation of Ticlopidine Hydrochloride (T438325), an antithrombotic. A platelet aggregation inhibitor. |
| | 6.7-dihydrothieno[3.2.c]pyridin-4(5H)-one Preparation Products And Raw materials |
|