| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Ruthenium II cyclooctadiene bis-(2,2,6,6-tetramethylheptanedionate) manufacturers
|
| | Ruthenium II cyclooctadiene bis-(2,2,6,6-tetramethylheptanedionate) Basic information | | Reaction |
| Product Name: | Ruthenium II cyclooctadiene bis-(2,2,6,6-tetramethylheptanedionate) | | Synonyms: | BIS-(2-METHYLALLYL)CYCLOOCTA-1,5-DIENE RUTHENIUM (II) COMPLEX;BIS(2-METHYLALLYL) (1,5-CYCLOOCTADIENE)&;BIS(2-METHYLALLYL)(1,5-CYCLOOCTADIENE)R&;RutheniumCyclooctadieneBis(2,2,6,6-Tetramethylheptanedionate);bis(2-methylallyl)(1,5-cyclooctadiene)ruthenium(ii),min.;Bis-(2-methylallyl)cycloocta-1,5-diene ruthenium(II) complex, 30-32% Ru;Bis(2-methylallyl)(1,5-cyclooctadiene)ruthenium(II),min.97%;Ruthenium(II) bis(2-methylallyl) 1,5-cyclooctadiene complex | | CAS: | 12289-94-0 | | MF: | C16H18Ru | | MW: | 311.39 | | EINECS: | | | Product Categories: | organometallic complex;Ru | | Mol File: | 12289-94-0.mol |  |
| | Ruthenium II cyclooctadiene bis-(2,2,6,6-tetramethylheptanedionate) Chemical Properties |
| Melting point | 81-85 °C | | Boiling point | 100°C/0.05mmHg | | storage temp. | -20°C | | form | Powder | | color | tan to brown | | Water Solubility | It is soluble in water. | | Sensitive | Air & Moisture Sensitive | | Stability: | store cold | | InChI | InChI=1S/C8H8.2C4H5.Ru/c1-2-4-6-8-7-5-3-1;2*1-4(2)3;/h1-2,7-8H2;2*1-2H,3H3;/q;2*-1;+2 | | InChIKey | KMYRLYRRLMVJNK-XMWBDPRZSA-N | | SMILES | CC12=C[Ru+2]345671(C=C3(C)[CH-]4)(C1CCC5=C6CCC7=1)[CH-]2 |
| Hazard Codes | Xn,F | | Risk Statements | 20/21/22-15 | | Safety Statements | 36/37-43 | | RIDADR | UN3395 | | WGK Germany | 3 | | TSCA | No | | HazardClass | 4.3 | | PackingGroup | III | | HS Code | 28439000 | | Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water | | Hazard Classifications | Water-react 3 |
| Provider | Language |
|
ACROS
| English |
| | Ruthenium II cyclooctadiene bis-(2,2,6,6-tetramethylheptanedionate) Usage And Synthesis |
| Reaction |
- Convenient precatalyst for Ru-catalyzed asymmetric hydrogenations (L2RuBr2 prepared in situ).
- β-ketoester reduction.
- Anti-Markovnikov addition of amides to alkynes.
- Anti-Markovnikov hydroamination of vinylarenes.
- Catalyst for the addition of amides to alkynes.
| | Chemical Properties | tan/brown powder | | Uses | Bis(2-methylallyl)(1,5-cyclooctadiene)ruthenium(II) is used as a catalyst and pharmaceutical intermediate. It is also used as a precatalysts for asymmetric and Cross-Coupling Catalysis reactions, and in organic chemical synthesis. | | Uses | Umicore Precatalysts for Asymmetric and Cross-Coupling Catalysis | | General Description | This product has been enhanced for catalytic efficiency. | | reaction suitability | core: ruthenium
reagent type: catalyst |
| | Ruthenium II cyclooctadiene bis-(2,2,6,6-tetramethylheptanedionate) Preparation Products And Raw materials |
|