BIS(ETHYLCYCLOPENTADIENYL)RUTHENIUM(II) manufacturers
|
| | BIS(ETHYLCYCLOPENTADIENYL)RUTHENIUM(II) Basic information | | Reaction |
| Product Name: | BIS(ETHYLCYCLOPENTADIENYL)RUTHENIUM(II) | | Synonyms: | Bis(ethylcyclopentadienyl)ruthenium(II), 98% (99.9%-Ru), 44-0040, contained in 50 ml Swagelok cylinder for CVD/ALD;DIETHYLRUTHENOCENE;ETHYL RUTHENOCENE;BIS(ETHYLCYCLOPENTADIENYL) RUTHENIUM;BIS(ETHYLCYCLOPENTADIENYL)RUTHENIUM(II);Bis(ethylcyclopentadienyl)ruthenium(II),98%(99.9%-Ru);BIS(ETHYLCYCLOPENTADIENYL)RUTHENIUM(II) (99.9% RU);Bis(ethylcyclopentadienyl)rutheniuM(II),98% | | CAS: | 32992-96-4 | | MF: | C14H10Ru | | MW: | 279.3 | | EINECS: | | | Product Categories: | Ru;metallocene | | Mol File: | 32992-96-4.mol |  |
| | BIS(ETHYLCYCLOPENTADIENYL)RUTHENIUM(II) Chemical Properties |
| Melting point | 6 °C (lit.) | | Boiling point | 100 °C/0.01 mmHg (lit.) | | density | 1.3412 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5870(lit.) | | Fp | >200 °F | | storage temp. | -20°C | | form | liquid | | color | pale yellow | | Specific Gravity | 1.341 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/2C7H5.Ru/c2*1-2-7-5-3-4-6-7;/h2*2H2,1H3;/q2*-1;+2 | | InChIKey | HXJQELBDFQFTHS-UHFFFAOYSA-N | | SMILES | C([C-]12C3=C4C5=C1[Ru+2]16782345C2C1=C6[C-]7(CC)C8=2)C |
| Hazard Codes | Xi | | Risk Statements | 14/15-36/37/38 | | Safety Statements | 26-43 | | RIDADR | UN 3398 4.3/PG 2 | | WGK Germany | 3 | | TSCA | No | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | BIS(ETHYLCYCLOPENTADIENYL)RUTHENIUM(II) Usage And Synthesis |
| Reaction |
- Ligand used to make chiral oxaborolidines for the enantioselective alkynylation of aldehydes
- Ligand used in organoindium reagents for asymmetric Barbier-type allylations
- Ligand used in organoindium reagents for asymmetric Barbier-type propargylations
| | Uses | Bis(ethylcyclopentadienyl)ruthenium(II) (Ru(EtCp)2), a metal organic is used as an atomic layer deposition precursor for Ru thin filmsand well-aligned RuO2 nanorods. | | reaction suitability | core: ruthenium reagent type: catalyst |
| | BIS(ETHYLCYCLOPENTADIENYL)RUTHENIUM(II) Preparation Products And Raw materials |
|