5-butyl-1H-benzotriazole manufacturers
|
| | 5-butyl-1H-benzotriazole Basic information |
| Product Name: | 5-butyl-1H-benzotriazole | | Synonyms: | 5-butyl-1H-benzotriazole;5-Butylbenzotriazole;5-n-Butylbenzotriazole;5-Butyl-1H-benzo[d][1,2,3]triazole;5-Butyl-1H-benzotriazole 98%;1H-Benzotriazole, 6-butyl-;5-butyl-2H-benzotriazole | | CAS: | 3663-24-9 | | MF: | C10H13N3 | | MW: | 175.23 | | EINECS: | | | Product Categories: | | | Mol File: | 3663-24-9.mol |  |
| | 5-butyl-1H-benzotriazole Chemical Properties |
| Melting point | 75℃ (ligroine ) | | Boiling point | 202 °C(Press: 11 Torr) | | density | 1.136±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 8.58±0.40(Predicted) | | InChI | InChI=1S/C10H13N3/c1-2-3-4-8-5-6-9-10(7-8)12-13-11-9/h5-7H,2-4H2,1H3,(H,11,12,13) | | InChIKey | ZCFMGIGLXOKMJC-UHFFFAOYSA-N | | SMILES | N1C2=CC(CCCC)=CC=C2N=N1 | | EPA Substance Registry System | 5-Butyl-1H-benzotriazole (3663-24-9) |
| TSCA | TSCA listed | | HS Code | 2933998090 |
| | 5-butyl-1H-benzotriazole Usage And Synthesis |
| Uses | As a derivative of benzotriazole, 5-butyl-1H-benzotriazole can participate in a variety of chemical reactions to synthesize novel compounds with specific functions. In scientific research and industry, it is often used to prepare fine chemicals such as dyes, bactericides, and antifungal agents, and is a basic structural unit for constructing complex organic molecular structures. | | Synthesis | Starting with 4-n-butylaniline, 4-n-butylacetaniline was first prepared by reacting it with acetic anhydride and concentrated sulfuric acid. Subsequently, 4-n-butylacetaniline underwent a series of reactions including nitration, hydrolysis, and diazotization, ultimately yielding 5-butyl-1H-benzotriazole via a cyclization reaction. |
| | 5-butyl-1H-benzotriazole Preparation Products And Raw materials |
|