| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 5,6-Dimethyl-1,2,3-benzotriazole hydrate Basic information |
| Product Name: | 5,6-Dimethyl-1,2,3-benzotriazole hydrate | | Synonyms: | TIMTEC-BB SBB004093;5,6-Dimethyl-1H-benzotriazole hydrate 98%;5,6-DIMETHYL-1H-BENZOTRIAZOLE HYDRATE, 9 9%;5,6-dimethyl-1h-benzotriazole monohydrate;5,6-dimethylazimidobenzene;5,6-dimethyl-2H-benzotriazole hydrate;5,6-dimethyl-1H-1,2,3-benzotriazole(SALTDATA: FREE);5,6-DIMETHYLAZIMIDOBENZENE HYDRATE | | CAS: | 4184-79-6 | | MF: | C8H9N3 | | MW: | 147.18 | | EINECS: | 224-058-3 | | Product Categories: | Benzotriazoles;Building Blocks;Heterocyclic Building Blocks | | Mol File: | 4184-79-6.mol |  |
| | 5,6-Dimethyl-1,2,3-benzotriazole hydrate Chemical Properties |
| Melting point | 152-156 °C(lit.) | | Boiling point | 373.5±11.0 °C(Predicted) | | density | 1.217±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | pka | 8.92±0.40(Predicted) | | form | Crystalline Powder | | color | Yellow to brown | | BRN | 122933 | | InChI | InChI=1S/C8H9N3/c1-5-3-7-8(4-6(5)2)10-11-9-7/h3-4H,1-2H3,(H,9,10,11) | | InChIKey | MVPKIPGHRNIOPT-UHFFFAOYSA-N | | SMILES | N1C2=CC(C)=C(C)C=C2N=N1 | | CAS DataBase Reference | 4184-79-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29339980 |
| | 5,6-Dimethyl-1,2,3-benzotriazole hydrate Usage And Synthesis |
| Chemical Properties | yellow to brown crystalline powder | | Uses | 5,6-Dimethyl-1,2,3-benzotriazoleHydrate (cas# 4184-79-6) is a benzotriazole derivatives. Benzotriazoles are mainly used as corrosion inhibitors, and are widely distributed in the environment. Benzotriazoles derivatives are found in plastics, dishwasher detergents, dry cleaning equipment, and de-icing/anti-icing fluids. |
| | 5,6-Dimethyl-1,2,3-benzotriazole hydrate Preparation Products And Raw materials |
|