- FLURENOL
-
- $1.00 / 1KG
-
2025-12-12
- CAS:467-69-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000KG
|
| | 9-Hydroxy-9-fluorenecarboxylic acid Basic information |
| | 9-Hydroxy-9-fluorenecarboxylic acid Chemical Properties |
| Melting point | 162-166 °C (lit.) | | BRN | 1314711 | | InChI | 1S/C14H10O3/c15-13(16)14(17)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,17H,(H,15,16) | | InChIKey | GXAMYUGOODKVRM-UHFFFAOYSA-N | | SMILES | OC(=O)C1(O)c2ccccc2-c3ccccc13 | | CAS DataBase Reference | 467-69-6(CAS DataBase Reference) | | EPA Substance Registry System | Flurenol (467-69-6) |
| Hazard Codes | N,Xi | | Risk Statements | 51/53-36/37/38 | | Safety Statements | 61-36/37/39-27-26 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 2 | | RTECS | LL6480000 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29181990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 | | Toxicity | mouse,LD50,oral,> 5gm/kg (5000mg/kg),Pesticide Manual. Vol. 9, Pg. 417, 1991. |
| | 9-Hydroxy-9-fluorenecarboxylic acid Usage And Synthesis |
| Uses | 9-Hydroxy-9-fluorenecarboxylic acid was used in the synthesis of a hexameric organooxotin prismane. | | Definition | ChEBI: Flurecol is a member of fluorenes. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 16, p. 279, 1951 DOI: 10.1021/jo01142a018 |
| | 9-Hydroxy-9-fluorenecarboxylic acid Preparation Products And Raw materials |
|