- GNF-5
-
- $30.00 / 10mg
-
2026-04-21
- CAS:778277-15-9
- Min. Order:
- Purity: 99.93%
- Supply Ability: 10g
- GNF5
-
- $5.00 / 5KG
-
2019-09-04
- CAS:778277-15-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1ton
|
| Product Name: | GNF5 | | Synonyms: | GNF 5;GNF5;GNF-5;N-(2-Hydroxyethyl)-3-[6-[[4-(trifluoromethoxy)phenyl]amino]-4-pyrimidinyl]benzamide;ert-butyl 2-oxopiperidine-1-carboxylate;GNF 5 N-(2-Hydroxyethyl)-3-[6-[[4-(trifluoromethoxy)phenyl]amino]-4-pyrimidinyl]benzamide;N-(2-Hydroxyethyl)-3-[6-[[4-(trifluoromethoxy)phenyl]amino]-4-pyrimidinyl]benzamide GNF-5;GNF-5, >=98% | | CAS: | 778277-15-9 | | MF: | C20H17F3N4O3 | | MW: | 418.37 | | EINECS: | 200-256-5 | | Product Categories: | Inhibitors | | Mol File: | 778277-15-9.mol |  |
| Boiling point | 612.4±55.0 °C(Predicted) | | density | 1.385±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO: soluble10mg/mL (clear solution) | | form | powder | | pka | 13.36±0.46(Predicted) | | color | white to beige | | InChI | 1S/C20H17F3N4O3/c21-20(22,23)30-16-6-4-15(5-7-16)27-18-11-17(25-12-26-18)13-2-1-3-14(10-13)19(29)24-8-9-28/h1-7,10-12,28H,8-9H2,(H,24,29)(H,25,26,27) | | InChIKey | IIQUYGWWHIHOCF-UHFFFAOYSA-N | | SMILES | OCCNC(=O)c1cccc(c1)-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2 |
| Hazard Codes | T | | Risk Statements | 25-36 | | Safety Statements | 22-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| Uses | GNF-5 is a selective and allosteric Bcr-Abl inhibitor. It is a COVID19-related research product. | | Biological Activity | GNF-5 is a BRC-Abl inhibitor. | | in vivo | GNF-5 (5 mg/kg iv. or 20 mg/kg oral) has suitable pharmacokinetic parameters[1].
GNF-5 (oral, 50 or 100 mg/kg, twice daily, for 7 days) shows efficacious in vivo but can observe relapses[1].
GNF-5 (75 mg/kg, b.i.d) inhibits T315I Bcr-Abl combination with nilotinib in vivo[1]. | Animal Model: | Male Balb/c mice[1] | | Dosage: | 5 mg/kg, 20 mg/kg | | Administration: | 5 mg/kg intravenously or 20 mg/kg orally | | Result: | | AUC_inf (min*ug/mL) | 292.37 | | AUC_inf (hrs*nM | 11647 | | Cmax(nM) | 4386.08 | | Tmax(hrs) | 0.50 | | Clast (nM) | 636.16 | | T1/2(hrs) | 2.30 | | Vss(L/kg) | 9.18 | | F (%) | 44.82 | |
|
| Animal Model: | p210 xenograft model[1] | | Dosage: | 50 or 100 mg/kg | | Administration: | oral, twice daily, for 7 days | | Result: | Could normalize blood counts and spleen size. |
| Animal Model: | Bone marrow transduction/transplantation model[1] | | Dosage: | 75 mg/kg | | Administration: | twice daily | | Result: | Showed no significant response (alone).
Showed no toxicity and had a strong and sustained inhibition of Bcr-Abl-mediated signaling combination with nilotinib.
|
| | storage | Store at +4°C |
| | GNF5 Preparation Products And Raw materials |
|