- Isoleucine Valsartan
-
- $1.00
-
2020-02-02
- CAS:137862-78-3
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 200g
|
| | Isoleucine Valsartan Basic information |
| Product Name: | Isoleucine Valsartan | | Synonyms: | 503-12;N-pentanoyl-N-[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-ylmethyl]-L-isoleucine;(2S)-2-(N-((2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)methyl)pentanamido)-3-methylpentanoic acid;N-((2'-(1H-tetrazol-5-yl)-[1,1'-
biphenyl]-4-yl)methyl)-N-pentanoyl-
L-isoleucine;Isoleucine Valsartan;Valsartan impurity 3/Isoleucine Valsartan/N-((2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)Methyl)-N-pentanoyl-L-isoleucine;Isoleucine Valsartan (Impurity D);Valsartan-4 | | CAS: | 137862-78-3 | | MF: | C25H31N5O3 | | MW: | 449.55 | | EINECS: | | | Product Categories: | Aromatics, Chiral Reagents, Heterocycles | | Mol File: | 137862-78-3.mol |  |
| | Isoleucine Valsartan Chemical Properties |
| Melting point | >96oC (dec.) | | Boiling point | 691.2±65.0 °C(Predicted) | | density | 1.196±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.60±0.20(Predicted) | | color | White to Off-White | | InChIKey | PTLZEWHOZCZLAQ-SBUREZEXSA-N | | SMILES | C(O)(=O)[C@H]([C@@H](C)CC)N(C(=O)CCCC)CC1=CC=C(C2=CC=CC=C2C2=NNN=N2)C=C1 |
| | Isoleucine Valsartan Usage And Synthesis |
| Uses | Isoleucine Valsartan is a Valsartan (V095750) impurity. Valsartan is A nonpeptide angiotensin II AT1-receptor antagonist. Antihypertensive. |
| | Isoleucine Valsartan Preparation Products And Raw materials |
|