|
|
| | Valsartan n-Propyl Basic information |
| Product Name: | Valsartan n-Propyl | | Synonyms: | Valsartan n-Propyl;Valsartan n-Propyl Impurity;L-Valine, N-(1-oxobutyl)-N-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4- yl]methyl]-;(S)-N-Butyryl-N-([2'-(1H-tetrazole-5-yl)biphen-4-yl]methyl)valine;Valsartan n-Propyl IMpurity：(S)-N-butyryl-N-{[2'-(1-H-tetrazole-5-yl)-biphenyl-4-yl]-Methyl}-valine;N-butyryl-N-{[2'-(1H-tetrazole-5-yl)-biphenyl-4-yl]Methyl}-L-valine;N-(1-Oxobutyl)-N-[[2'-(2H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]Methyl]-;(S)-2-(N-((2'-(1H-tetrazol-5-yl)-[1,1'-biphenyl]-4-yl)Methyl)butyraMido)-3-Methylbutanoic acid | | CAS: | 952652-79-8 | | MF: | C23H27N5O3 | | MW: | 421.49 | | EINECS: | | | Product Categories: | Amino Acids & Derivatives;Aromatics;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 952652-79-8.mol |  |
| | Valsartan n-Propyl Chemical Properties |
| Melting point | >149·C (dec.) | | Boiling point | 679.0±65.0 °C(Predicted) | | density | 1.230±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.56±0.10(Predicted) | | color | White to Pale Yellow | | Major Application | pharmaceutical (small molecule) | | InChIKey | OKAQHVJSXLGXET-NRFANRHFSA-N | | SMILES | C(O)(=O)[C@H](C(C)C)N(C(=O)CCC)CC1=CC=C(C2=CC=CC=C2C2=NNN=N2)C=C1 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Repr. 2
STOT SE 3 |
| | Valsartan n-Propyl Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Valsartan n-Propyl is an impurity in the synthesis of Valsartan (V095750). Valsartan USP Related Compound B. |
| | Valsartan n-Propyl Preparation Products And Raw materials |
|