|
|
| | Perovskite CH3NH3PbI3 Powder Basic information |
| Product Name: | Perovskite CH3NH3PbI3 Powder | | Synonyms: | CH3NH3PbI3;Perovskite CH3NH3PbI3 Powder;Methylammonium triiodoplumbate;Methylammonium leadiodide;Methylammonium leadiodide 40% - butyrolactone;METHYLAMMONIUMTRIIODOPLUMBATE(II)(40WT%SOLUTIONINDMF)(99.99+%-PB);CH3NH3PbI3 (MAPbI3);Methylammonium Iodide PerovskiteMethylammonium Lead Iodide | | CAS: | 69507-98-8 | | MF: | CH5N.H.I3Pb | | MW: | 620 | | EINECS: | 809-771-5 | | Product Categories: | | | Mol File: | 69507-98-8.mol |  |
| | Perovskite CH3NH3PbI3 Powder Chemical Properties |
| Melting point | 377 °C | | density | 1.368 | | storage temp. | 2-8°C, sealed storage, away from moisture | | form | liquid | | color | clear yellow | | InChI | InChI=1S/CH5N.3HI.Pb/c1-2;;;;/h2H2,1H3;3*1H;/q;;;;+2/p-2 | | InChIKey | OAVDNKDAQKEIHT-UHFFFAOYSA-L | | SMILES | CN.[Pb+2]([I-])([I-])[I-].[H+] |
| | Perovskite CH3NH3PbI3 Powder Usage And Synthesis |
| Application | Perovskite CH3NH3PbI3 Powder can convert most of the light energy into electrical energy and can be used to manufacture high-efficiency solar cells. | | Advantages |
Perovskite CH3NH3PbI3 Powder has the advantages:
High photoelectric conversion efficiency: The photoelectric conversion efficiency of perovskite MAPbI3 is very high;
Wide spectral response: Perovskite MAPbI3 has a very wide absorption spectral range, including light in the visible and near-infrared spectral ranges;
Good stability: perovskite MAPbI3 has good stability and durability;
Good controllability: Perovskite MAPbI3 can achieve performance regulation by adjusting the crystal structure and composition.
|
| | Perovskite CH3NH3PbI3 Powder Preparation Products And Raw materials |
|