| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:METHYL LAURATE
CAS:29972-79-0
|
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
| Products Intro: |
Product Name:Methyl 11-dodecenoate
CAS:29972-79-0
Purity:99%+ Package:1g;10g;100g;1KG;5KG
|
| Company Name: |
Chengdu Senior Pharma Technology Co.Ltd.
|
| Tel: |
+86-0838-2319818 +86-15982001943 |
| Email: |
seniorpharma@163.com |
| Products Intro: |
Product Name:Methyl dodec-11-enoate
CAS:29972-79-0
Purity:95% Package:1g；5g；10g；25g；50g；100g
|
| Company Name: |
JinJin Le Chemical Co., Ltd
|
| Tel: |
18001959627(微信同号) 18001959627 |
| Email: |
jjlchem2@163.com |
| Products Intro: |
CAS:29972-79-0
Purity:On Request Package:电询
|
|
| | METHYL LAURATE Basic information |
| Product Name: | METHYL LAURATE | | Synonyms: | RARECHEM AL BF 0157;Methyl 11-cis-dodecenoate;METHYL-DODECANATE;METHYL DODECANOATE;C12:0 METHYL ESTER;11-Dodecenoic acid, methyl ester;11-cis-DODECENOIC METHYL;Methyl dodec-11-enoate | | CAS: | 29972-79-0 | | MF: | C13H24O2 | | MW: | 212.33 | | EINECS: | 2039113 | | Product Categories: | | | Mol File: | 29972-79-0.mol |  |
| | METHYL LAURATE Chemical Properties |
| Melting point | 4-5 °C(lit.) | | Boiling point | 262 °C766 mm Hg(lit.) | | density | 0.87 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.432 | | Fp | >230 °F | | storage temp. | 2-8°C | | Dielectric constant | 3.6000000000000001 | | InChI | InChI=1S/C13H24O2/c1-3-4-5-6-7-8-9-10-11-12-13(14)15-2/h3H,1,4-12H2,2H3 | | InChIKey | ZIPHBQHTAWKZCG-UHFFFAOYSA-N | | SMILES | C(OC)(=O)CCCCCCCCCC=C | | CAS DataBase Reference | 29972-79-0(CAS DataBase Reference) |
| WGK Germany | 1 | | RTECS | OF0670000 |
| | METHYL LAURATE Usage And Synthesis |
| Chemical Properties | Water-white liquid.Insoluble in water.Noncorrosive. Combustible. | | Uses | Intermediate for detergents, emulsifiers, wet-ting agents, stabilizers, lubricants, plasticizers, tex-tiles, flavoring. | | Definition | Themethyl ester of lauric acid. | | Synthesis Reference(s) | Tetrahedron Letters, 18, p. 4361, 1977 DOI: 10.1016/S0040-4039(01)83508-5 |
| | METHYL LAURATE Preparation Products And Raw materials |
|