| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-(Trifluoromethoxy)phenylboronic acid, pinacol ester manufacturers
|
| | 3-(Trifluoromethoxy)phenylboronic acid, pinacol ester Basic information |
| Product Name: | 3-(Trifluoromethoxy)phenylboronic acid, pinacol ester | | Synonyms: | 4,4,5,5-TETRAMETHYL-2-(3-TRIFLUOROMETHOXYPHENYL)-1,3,2-DIOXABOROLANE;4,4,5,5-Tetramethyl-2-(3-trifluoromethoxyphenyl)-;5-TetraMethyl-2-(3-trifluoroMethoxyphenyl)-1;3-(Trifluoromethoxy)benzeneboronic acid, pinacol ester;4,4,5,5-Tetramethyl-2-[3-(trifluoromethoxy)phenyl]-1,3,2-dioxaborolane, 3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-alpha,alpha,alpha-trifluoroanisole;1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[3-(trifluoromethoxy)phenyl]-;1-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethoxy)benzene;4,4,5,5-tetramethyl-2-[3-(trifluoromethoxy)phenyl]-1,3,2-dio... | | CAS: | 262376-31-8 | | MF: | C13H16BF3O3 | | MW: | 288.07 | | EINECS: | 675-105-3 | | Product Categories: | | | Mol File: | 262376-31-8.mol |  |
| | 3-(Trifluoromethoxy)phenylboronic acid, pinacol ester Chemical Properties |
| Boiling point | 299.7±40.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | refractive index | 1.4440 to 1.4480 | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | 1S/C13H16BF3O3/c1-11(2)12(3,4)20-14(19-11)9-6-5-7-10(8-9)18-13(15,16)17/h5-8H,1-4H3 | | InChIKey | BUSBFOTXIPZTDH-UHFFFAOYSA-N | | SMILES | B2(OC(C(O2)(C)C)(C)C)c1cc(ccc1)OC(F)(F)F |
| Risk Statements | 43 | | Safety Statements | 36/37 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Skin Sens. 1 |
| | 3-(Trifluoromethoxy)phenylboronic acid, pinacol ester Usage And Synthesis |
| | 3-(Trifluoromethoxy)phenylboronic acid, pinacol ester Preparation Products And Raw materials |
|