| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Methoxyphenylboronic Acid Pinacol Ester Basic information |
| Product Name: | 3-Methoxyphenylboronic Acid Pinacol Ester | | Synonyms: | 2-(3-METHOXYLOXYPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;3-METHOXYPHENYLBORONIC ACID, PINACOL ESTER;2-(3-Methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-;2-(3-Methoxyloxyphenyl)-4;3-Methoxybenzeneboronic acid, pinacol ester;4,4,5,5-tetraMethyl-2-[3-(Methylperoxy)phenyl]-1,3,2-dioxaborolane;3-Methoxy-1-(4,4,5,5-tetraMethyl-1,3,2-dioxaborolan-2-yl)benzene;M-(Pinacolboryl)anisol | | CAS: | 325142-84-5 | | MF: | C13H19BO3 | | MW: | 234.1 | | EINECS: | | | Product Categories: | | | Mol File: | 325142-84-5.mol |  |
| | 3-Methoxyphenylboronic Acid Pinacol Ester Chemical Properties |
| Boiling point | 328.2±25.0 °C(Predicted) | | density | 1.028 g/mL at 25 °C | | refractive index | n20/D1.502 | | Fp | >110℃ | | storage temp. | 2-8°C | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | 1S/C13H19BO3/c1-12(2)13(3,4)17-14(16-12)10-7-6-8-11(9-10)15-5/h6-9H,1-5H3 | | InChIKey | DMKREZLZDOSDQU-UHFFFAOYSA-N | | SMILES | COc1cccc(c1)B2OC(C)(C)C(C)(C)O2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Methoxyphenylboronic Acid Pinacol Ester Usage And Synthesis |
| Uses | 3-Methoxyphenylboronic Acid Pinacol Ester is used in the preparation of inhibitors of TGF-β1 and activin A signalling. |
| | 3-Methoxyphenylboronic Acid Pinacol Ester Preparation Products And Raw materials |
|