| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3'-Hydroxybiphenyl-4-carbonitrile Basic information |
| Product Name: | 3'-Hydroxybiphenyl-4-carbonitrile | | Synonyms: | 4-(3-HYDROXYPHENYL)BENZONITRILE;AKOS BAR-0926;3μ-Hydroxy-[1,1μ-biphenyl]-4-carbonitrile, 3μ-Hydroxybiphenyl-4-carbonitrile;SALOR-INT L300748-1EA;3'-HYDROXY-[1,1'-BIPHENYL]-4-CARBONITRILE;3'-Hydroxy[1,1'-biphenyl]-4-carbonitrile;3'-Hydroxybiphenyl-4-carbonitrile | | CAS: | 486455-27-0 | | MF: | C13H9NO | | MW: | 195.22 | | EINECS: | | | Product Categories: | | | Mol File: | 486455-27-0.mol |  |
| | 3'-Hydroxybiphenyl-4-carbonitrile Chemical Properties |
| Melting point | 160-164 °C (lit.) | | Boiling point | 408.0±38.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | pka | 9.46±0.10(Predicted) | | form | solid | | InChI | 1S/C13H9NO/c14-9-10-4-6-11(7-5-10)12-2-1-3-13(15)8-12/h1-8,15H | | InChIKey | LYCMNMIPSJWQRL-UHFFFAOYSA-N | | SMILES | Oc1cccc(c1)-c2ccc(cc2)C#N |
| Hazard Codes | Xn,N | | Risk Statements | 20/21/22-41-51/53 | | Safety Statements | 26-36/37/39-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Dam. 1 |
| | 3'-Hydroxybiphenyl-4-carbonitrile Usage And Synthesis |
| | 3'-Hydroxybiphenyl-4-carbonitrile Preparation Products And Raw materials |
|