| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4'-Hydroxybiphenyl-3-carbonitrile Basic information |
| Product Name: | 4'-Hydroxybiphenyl-3-carbonitrile | | Synonyms: | SALOR-INT L300713-1EA;3-(4-HYDROXYPHENYL)BENZONITRILE;4μ-Hydroxy-[1,1μ-biphenyl]-3-carbonitrile, 4μ-Hydroxybiphenyl-3-carbonitrile;4-(3-Cyanophenyl)phenol;4'-hydroxy-3-biphenylcarbonitrile;4'-HYDROXY[1,1'-BIPHENYL]-3-CARBONITRILE;AKOS BAR-0928;[1,1'-Biphenyl]-3-carbonitrile, 4'-hydroxy- | | CAS: | 154848-44-9 | | MF: | C13H9NO | | MW: | 195.22 | | EINECS: | | | Product Categories: | | | Mol File: | 154848-44-9.mol |  |
| | 4'-Hydroxybiphenyl-3-carbonitrile Chemical Properties |
| Melting point | 164-168 °C (lit.) | | Boiling point | 373.4±25.0 °C(Predicted) | | density | 1.24±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 9.52±0.26(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C13H9NO/c14-9-10-2-1-3-12(8-10)11-4-6-13(15)7-5-11/h1-8,15H | | InChIKey | DTNKYIRPORWHHR-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(O)C=C2)=CC=CC(C#N)=C1 |
| Hazard Codes | Xn,N | | Risk Statements | 20/21/22-41-51/53 | | Safety Statements | 26-36/37/39-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1 |
| | 4'-Hydroxybiphenyl-3-carbonitrile Usage And Synthesis |
| | 4'-Hydroxybiphenyl-3-carbonitrile Preparation Products And Raw materials |
|