| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 2-Chloro-4-fluoroanisole
-
- $100.00
-
2024-04-22
- CAS:2267-25-6
- Min. Order: 1kg
- Purity: 99.93%
- Supply Ability: 1000kg per week
|
| | 2-Chloro-4-fluoroanisole Basic information |
| | 2-Chloro-4-fluoroanisole Chemical Properties |
| Boiling point | 197-200 °C (lit.) | | density | 1.29 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.519(lit.) | | Fp | 170 °F | | storage temp. | Sealed in dry,Room Temperature | | form | Liquid | | Specific Gravity | 1.29 | | color | Clear colorless to light yellow | | InChI | InChI=1S/C7H6ClFO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,1H3 | | InChIKey | RKCGJVGMRPKPNY-UHFFFAOYSA-N | | SMILES | C1(OC)=CC=C(F)C=C1Cl | | CAS DataBase Reference | 2267-25-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | 1993 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29093090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Chloro-4-fluoroanisole Usage And Synthesis |
| Chemical Properties | Transparent light yellow liquid |
| | 2-Chloro-4-fluoroanisole Preparation Products And Raw materials |
|