|
|
| | L-Pyroglutamic acid beta-naphthylamide Basic information |
| | L-Pyroglutamic acid beta-naphthylamide Chemical Properties |
| Melting point | 188-193°C | | Boiling point | 616.9±48.0 °C(Predicted) | | density | 1.311±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | methanol: 50 mg/mL, clear, colorless | | form | powder | | pka | 13.51±0.20(Predicted) | | color | White | | BRN | 5066652 | | InChI | 1S/C15H14N2O2/c18-14-8-7-13(17-14)15(19)16-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8H2,(H,16,19)(H,17,18)/t13-/m0/s1 | | InChIKey | BZEPQNMASTUAMY-ZDUSSCGKSA-N | | SMILES | O=C1CC[C@H](N1)C(=O)Nc2ccc3ccccc3c2 | | CAS DataBase Reference | 22155-91-5(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22-50/53 | | Safety Statements | 22-24/25-61-60 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | F | 10-21 | | HS Code | 2933790090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | L-Pyroglutamic acid beta-naphthylamide Usage And Synthesis |
| Chemical Properties | L-PYROGLUTAMIC ACID BETA-NAPHTHYLAMIDE is Light Pink-White Crystals | | Uses | Substrate for the assay of pyrrolidonylpeptidase. | | Uses | L-PYROGLUTAMIC ACID BETA-NAPHTHYLAMIDE is a substrate for pyroglutamate aminopeptidase. Used for colorimetric determination of pyrrolidonyl peptidase activity in bacteria | | Uses | A substrate for pyroglutamate aminopeptidase. Used for differentiation of Group A streptococci and enterococci from other streptococci. | | Definition | ChEBI: An L-proline derivative that is the amide obtained by formal condensation of the carboxy group of 5-oxo-L-proline with the amino group of 2-naphthylamine. | | Biochem/physiol Actions | Pyroglutamic acid is known to participate in the gamma-glutamyl cycle. Recent studies show that a congenital metabolic error was associated with increased pyroglutamic excretion in urine. |
| | L-Pyroglutamic acid beta-naphthylamide Preparation Products And Raw materials |
|