- Boc-Val-Cit-PAB
-
- $32.00
-
2026-04-22
- CAS:870487-09-5
- Purity: 99.34%
- Supply Ability: 10g
- Boc-Val-Cit-PAB
-
-
2025-06-07
- CAS:870487-09-5
- Min. Order: 5g
- Purity: >99.00%
- Supply Ability: 5g
|
| | Boc-Val-Cit-PABA Basic information |
| Product Name: | Boc-Val-Cit-PABA | | Synonyms: | Boc-Val-Cit-PABA;N-[(1,1-Dimethylethoxy)carbonyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-L-ornithinamide;(S)-2-[(S)-2-(Boc-amino)-3-methylbutanamido]-N-[4-(hydroxymethyl)phenyl]-5-ureidopentanamide;L-Ornithinamide, N-[(1,1-dimethylethoxy)carbonyl]-L-valyl-N5-(aminocarbonyl)-N-[4-(hydroxymethyl)phenyl]-;Pentanoicacid,2,6-dioxo-,methylester;Inhibitor,inhibit,ADC Linkers,Boc Val Cit PAB,BocValCitPAB,Antibody-drug conjugates linkers;Boc-Gly-Gly-Phe-Gly;Boc-Val-Cit-PAB-OH | | CAS: | 870487-09-5 | | MF: | C23H37N5O6 | | MW: | 479.57 | | EINECS: | | | Product Categories: | Linker;ADC LINKER;ADCs | | Mol File: | 870487-09-5.mol |  |
| | Boc-Val-Cit-PABA Chemical Properties |
| Boiling point | 771.3±60.0 °C(Predicted) | | density | 1.209±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO : 100 mg/mL (208.52 mM; Need ultrasonic) | | pka | 11.25±0.46(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | NTAKMIJAGHASRI-ROUUACIJSA-N | | SMILES | C(N)(=O)[C@H](CCCNC(N)=O)N(C(=O)[C@H](C(C)C)NC(OC(C)(C)C)=O)C1=CC=C(CO)C=C1 |
| | Boc-Val-Cit-PABA Usage And Synthesis |
| Description | Boc-Val-Cit-PAB is a cleavable ADC linker. The Val-Cit peptide will specifically be cleaved by Cathepsin B. Boc group can be removed under acidic condition. | | Uses | Boc-Val-Cit-PAB is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. | | IC 50 | Protease Cleavable Linker; Cleavable Linker | | References | [1] Beck A, et al. Strategies and challenges for the next generation of antibody-drug conjugates. Nat Rev Drug Discov. 2017 May;16(5):315-337. DOI:10.1038/nrd.2016.268 |
| | Boc-Val-Cit-PABA Preparation Products And Raw materials |
|