6-CHLORO-3,4-PYRIDINEDIAMINE manufacturers
|
| | 6-CHLORO-3,4-PYRIDINEDIAMINE Basic information | | Application |
| Product Name: | 6-CHLORO-3,4-PYRIDINEDIAMINE | | Synonyms: | 6-chloropyridine-3,4-diamine;6-CHLORO-3,4-DIAMINOPYRIDINE;6-Chloropyridine-3,4-diamine ,96%;4,5-Diamino-2-chloropyridine;2-Chloro-4,5-diaminopyridine;6-Chloro-3,4-diaminepyridine;3,4-DiaMino-6-chloropyridine;6-CHLORO-3,4-PYRIDINEDIAMINE | | CAS: | 89182-17-2 | | MF: | C5H6ClN3 | | MW: | 143.57 | | EINECS: | | | Product Categories: | Heterocycle-Pyridine series;Building Blocks;Pyridine;Pyridines | | Mol File: | 89182-17-2.mol |  |
| | 6-CHLORO-3,4-PYRIDINEDIAMINE Chemical Properties |
| Melting point | 162 °C | | Boiling point | 409.3±40.0 °C(Predicted) | | density | 1.447±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | form | powder | | pka | 4.79±0.42(Predicted) | | color | Yellow | | InChI | InChI=1S/C5H6ClN3/c6-5-1-3(7)4(8)2-9-5/h1-2H,8H2,(H2,7,9) | | InChIKey | OQRXBXNATIHDQO-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC(N)=C1N |
| | 6-CHLORO-3,4-PYRIDINEDIAMINE Usage And Synthesis |
| Application | 3,4-Diamino-6-chloropyridine is a heterocyclic organic compound that can be used as a pharmaceutical intermediate. | | Chemical Properties | Pink solid | | Synthesis | Step 1: 2-Chloro-5-nitropyridin-4-amine (4.50 g, 25.93 mmol) was dissolved in ethyl acetate (100 mL) and nickel ruanne (0.45 g) was added. The reaction mixture was stirred at room temperature for 2 hours in a hydrogen atmosphere. After completion of the reaction, the catalyst was removed by filtration and the filtrate was concentrated under reduced pressure to give the crude 6-chloropyridine-3,4-diamine (4.00 g, about 100% yield) as a yellow oil. Mass spectrometry (ESI) analysis showed: m/z = 144.3 [M + 1]+. | | References | [1] Patent: WO2013/92940, 2013, A1. Location in patent: Page/Page column 54
[2] Patent: EP2017277, 2009, A1. Location in patent: Page/Page column 29 |
| | 6-CHLORO-3,4-PYRIDINEDIAMINE Preparation Products And Raw materials |
|