| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-Methyl-4-phenylpyrazole Basic information |
| Product Name: | 3-Methyl-4-phenylpyrazole | | Synonyms: | 3-METHYL-4-PHENYL-1H-PYRAZOLE;3-Methyl-4-phenyl pyrazole, GC 98%;3-METHYL-4-PHENYLPYRAZOLE 98%;5-methyl-4-phenyl-1H-pyrazole;3-methyl-4-phenyl-1H-pyrazole(SALTDATA: FREE);(3-Methyl-1H-pyrazol-4-yl)benzene;1H-Pyrazole, 3-methyl-4-phenyl-;3-Methyl-4-phenyl-1H-pyrazole | | CAS: | 13788-84-6 | | MF: | C10H10N2 | | MW: | 158.2 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;Heterocycles | | Mol File: | 13788-84-6.mol |  |
| | 3-Methyl-4-phenylpyrazole Chemical Properties |
| Melting point | 142-144°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | Boiling point | 321.2±21.0 °C(Predicted) | | density | 1.109±0.06 g/cm3(Predicted) | | pKa | 14.50±0.50(Predicted) | | form | Solid | | color | White to Light Yellow | | Water Solubility | Soluble in DMSO, Methanol. Insoluble in water. | | BRN | 3330 | | InChI | InChI=1S/C10H10N2/c1-8-10(7-11-12-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12) | | InChIKey | XTXZCNATVCIKTR-UHFFFAOYSA-N | | SMILES | N1C=C(C2=CC=CC=C2)C(C)=N1 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2933199090 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | 3-Methyl-4-phenylpyrazole Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 3-Methyl-4-phenylpyrazole (cas# 13788-84-6) is a compound useful in organic synthesis. | | Synthesis Reference(s) | Tetrahedron Letters, 29, p. 6001, 1988 DOI: 10.1016/S0040-4039(00)82251-0 |
| | 3-Methyl-4-phenylpyrazole Preparation Products And Raw materials |
|