| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Benzyl (2R,3S)-(1-carbamoyl-2-hydroxypropyl)carbamate Basic information |
| Product Name: | Benzyl (2R,3S)-(1-carbamoyl-2-hydroxypropyl)carbamate | | Synonyms: | N2-(Benzyloxycarbonyl)-L-threoninamide;N-Benzyloxycarbonyl-L-Threoninamide;benzyl [R-(R*,S*)]-(1-carbamoyl-2-hydroxypropyl)carbamate;CBZTA;[(2R,3S)-1-Amino-3-hydroxy-1-oxo-2-(phenylmethyl)butan-2-yl] carbamate;Benzyl (2R,3S)-(1-carbamoyl-2-hydroxypropyl)carbamate;CBZ-L-THREONINE AMIDE;N-Carbobenzyloxy-L-threoninamide | | CAS: | 49705-98-8 | | MF: | C12H16N2O4 | | MW: | 252.27 | | EINECS: | 256-436-9 | | Product Categories: | Threonine [Thr, T] | | Mol File: | 49705-98-8.mol |  |
| | Benzyl (2R,3S)-(1-carbamoyl-2-hydroxypropyl)carbamate Chemical Properties |
| Melting point | 82-83 °C | | Boiling point | 508.4±50.0 °C(Predicted) | | density | 1.263±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Powder | | pka | 10.96±0.46(Predicted) | | color | White | | BRN | 2335408 | | Major Application | peptide synthesis | | InChI | 1S/C12H16N2O4/c1-8(15)10(11(13)16)14-12(17)18-7-9-5-3-2-4-6-9/h2-6,8,10,15H,7H2,1H3,(H2,13,16)(H,14,17)/t8-,10+/m1/s1 | | InChIKey | PYZXYZOBPGPOFQ-SCZZXKLOSA-N | | SMILES | C[C@@H](O)[C@H](NC(=O)OCc1ccccc1)C(N)=O | | CAS DataBase Reference | 49705-98-8(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Benzyl (2R,3S)-(1-carbamoyl-2-hydroxypropyl)carbamate Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Threonine | | reaction suitability | reaction type: solution phase peptide synthesis |
| | Benzyl (2R,3S)-(1-carbamoyl-2-hydroxypropyl)carbamate Preparation Products And Raw materials |
|