- C29
-
- $47.00
-
2026-07-27
- CAS:363600-92-4
- Purity: 99.95%
- Supply Ability: 10g
- TLR2-IN-C29
-
- $1.00
-
2019-12-24
- CAS:363600-92-4
- Min. Order: 1g
- Purity: 99%
- Supply Ability: 20kg
|
| | TLR2-IN-C29 Basic information |
| Product Name: | TLR2-IN-C29 | | Synonyms: | C29;C 29;C-29;TLR2-IN-C29;R2-IN-C29;Benzoic acid, 3-[[(2-hydroxy-3-methoxyphenyl)methylene]amino]-2-methyl-;3-((2-Hydroxy-3-methoxybenzylidene)amino)-2-methylbenzoic acid;TLR2-IN-C29 (C29 );C29,TLR2,Inhibitor,hTLR2/1,inhibit,C-29,Toll-like,Toll-like Receptor (TLR),hTLR2/6,C 29;C29, 10 mM in DMSO | | CAS: | 363600-92-4 | | MF: | C16H15NO4 | | MW: | 285.3 | | EINECS: | | | Product Categories: | | | Mol File: | 363600-92-4.mol |  |
| | TLR2-IN-C29 Chemical Properties |
| Melting point | >192°C (dec.) | | Boiling point | 505.7±50.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.01±0.10(Predicted) | | color | Dark Orange | | Stability: | Moisture Sensitive | | InChI | InChI=1S/C16H15NO4/c1-10-12(16(19)20)6-4-7-13(10)17-9-11-5-3-8-14(21-2)15(11)18/h3-9,18H,1-2H3,(H,19,20) | | InChIKey | WTGMGRFVBFDHGQ-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC(N=CC2=CC=CC(OC)=C2O)=C1C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | TLR2-IN-C29 Usage And Synthesis |
| Uses | TLR2-IN-29 is a inhibitor of TLR2/1 and TLR2/6 signaling induced by synthetic and bacterial TLR2 agonists in human HEK-TLR2 and THP-1 cells, but only TLR2/1 signaling in murine macrophages. | | Biological Activity | TLR2-IN-C29 is a toll/IL-1 receptor resistance (TIR) domain BB loop-targeting, selective toll-like receptor 2 (TLR2) antagonist th at inhibits both human TLR2/1 and TLR2/6-mediated signaling (IC50 = 37.6/19.7 μM against 50 ng/mL Pam3CSK/Pam2CSK-induced reporter signal, respectively, using HEK293T TLR2/6 or TLR2/1 transfectants), while blocking only murine TLR2/1-, but not murine TLR2/6-, mediated signaling (1h 25-50 μM C29 treatment prior to 50 ng P3C/mL or 100 ng P2C/mL for 1h in murine macrophages), nor signaling induced by other TLR agonists and TNF-α. | | IC 50 | TLR2 |
| | TLR2-IN-C29 Preparation Products And Raw materials |
|