| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
Bromo-PEG4-CH2COOtBu manufacturers
- Bromo-PEG4-CH2CO2tBu
-
- $2.00
-
2026-08-25
- CAS:1807505-29-8
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | Bromo-PEG4-CH2COOtBu Basic information |
| Product Name: | Bromo-PEG4-CH2COOtBu | | Synonyms: | Bromo-PEG4-CH2COOtBu;Bromo-PEG4-CH2CO2tBu;Br-PEG4-CH2COOtBu;3,6,9,12-Tetraoxatetradecanoic acid, 14-bromo-, 1,1-dimethylethyl ester;Br-PEG4-CH2-Boc;Bromo-peg4-ch2co2tbutyl ester;tert-butyl 14-bromo-3,6,9,12-tetraoxatetradecan-1-oate;CH2COOH t-Bu Este-PEG4-bromo | | CAS: | 1807505-29-8 | | MF: | C14H27BrO6 | | MW: | 371.26 | | EINECS: | | | Product Categories: | | | Mol File: | 1807505-29-8.mol |  |
| | Bromo-PEG4-CH2COOtBu Chemical Properties |
| Boiling point | 402.2±35.0 °C(Predicted) | | density | 1.230±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | Liquid | | color | Light yellow to yellow | | InChI | InChI=1S/C14H27BrO6/c1-14(2,3)21-13(16)12-20-11-10-19-9-8-18-7-6-17-5-4-15/h4-12H2,1-3H3 | | InChIKey | PELYBQFWTCXTNW-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)COCCOCCOCCOCCBr |
| | Bromo-PEG4-CH2COOtBu Usage And Synthesis |
| Description | Bromo-PEG4-CH2CO2tBu is a PEG linker containing a bromide group and a t-butyl protected carboxyl group. The hydrophilic PEG spacer increases solubility in aqueous media. The bromide (Br) is a very good leaving group for nucleophilic substitution reactions. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | | Uses | Br-PEG4-CH2-Boc is a PEG- and Alkyl/ether-based PROTAC linker can be used in the synthesis of PROTACs[1]. | | IC 50 | PEGs; Alkyl/ether | | References | [1] Darren H. Wakefield, et al. Poly(vinyl ester) Polymers for In Vivo Nucleic Acid Delivery. US20130121954A1. |
| | Bromo-PEG4-CH2COOtBu Preparation Products And Raw materials |
|