N3-PEG12-OH manufacturers
- azido-PEG12-OH
-
-
2025-06-07
- CAS:1821464-55-4
- Min. Order: 1g
- Purity: >95.00%
- Supply Ability: 1g
|
| | N3-PEG12-OH Basic information |
| Product Name: | N3-PEG12-OH | | Synonyms: | Azide-PEG12-OH;N3-PEG12-alcohol;inhibit,PROTAC Linkers,AzidePEG12alcohol,Azide PEG12 alcohol,Inhibitor,Azide-PEG-12-alcohol;N3-PEG12-OH/3,6,9,12,15,18,21,24,27,30,33-Undecaoxapentatriacontan-1-ol, 35-azido-;N3-PEG12-OH;azido-PEG12-OH;N-PEG12-OH;Azide-PEG12-alcohol | | CAS: | 1821464-55-4 | | MF: | C24H49N3O12 | | MW: | 571.67 | | EINECS: | | | Product Categories: | | | Mol File: | 1821464-55-4.mol |  |
| | N3-PEG12-OH Chemical Properties |
| storage temp. | Storage temp. 2-8°C | | form | Liquid | | color | Colorless to light yellow | | InChI | InChI=1S/C24H49N3O12/c25-27-26-1-3-29-5-7-31-9-11-33-13-15-35-17-19-37-21-23-39-24-22-38-20-18-36-16-14-34-12-10-32-8-6-30-4-2-28/h28H,1-24H2 | | InChIKey | AFUKFRGNHZRMCW-UHFFFAOYSA-N | | SMILES | C(OCCOCCOCCOCCOCCOCCO)COCCOCCOCCOCCOCCN=[N+]=[N-] |
| | N3-PEG12-OH Usage And Synthesis |
| Uses | Azide-PEG12-alcohol is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azide-PEG12-alcohol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | IC 50 | PEGs | | References | [1] An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 DOI:10.1016/j.ebiom.2018.09.005 |
| | N3-PEG12-OH Preparation Products And Raw materials |
|