|
|
| | 4-Methylsulphonylbenzoic acid Basic information |
| | 4-Methylsulphonylbenzoic acid Chemical Properties |
| Melting point | 268-271 °C(lit.) | | Boiling point | 307.93°C (rough estimate) | | density | 1.4787 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | slight | | pka | pK1:3.64 (25°C) | | form | powder to crystal | | color | White to Almost white | | Water Solubility | slight | | InChI | 1S/C8H8O4S/c1-13(11,12)7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10) | | InChIKey | AJBWNNKDUMXZLM-UHFFFAOYSA-N | | SMILES | CS(=O)(=O)c1ccc(cc1)C(O)=O | | CAS DataBase Reference | 4052-30-6(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22 | | Safety Statements | 24/25-26 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29163100 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-Methylsulphonylbenzoic acid Usage And Synthesis |
| Chemical Properties | white powder | | Uses | 4-(Methylsulfonyl)benzoic acid has pKa value of 3.48 and 8.36 in water and methanol at 25°C. | | General Description | 4-(Methylsulfonyl)benzoic acid has pKa value of 3.48 and 8.36 in water and methanol at 25°C. |
| | 4-Methylsulphonylbenzoic acid Preparation Products And Raw materials |
|