|
|
| | Methyl 2-methylnicotinate Basic information |
| | Methyl 2-methylnicotinate Chemical Properties |
| Boiling point | 102-104°C 10mm | | density | 1.104±0.06 g/cm3(Predicted) | | refractive index | 1.5165 | | Fp | 102-104°C/10mm | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in chloroform and methanol. | | pka | 3.92±0.10(Predicted) | | form | Oil | | color | Colourless to Dark Yellow | | BRN | 471919 | | InChI | InChI=1S/C8H9NO2/c1-6-7(8(10)11-2)4-3-5-9-6/h3-5H,1-2H3 | | InChIKey | KLHWBYHFWALOIJ-UHFFFAOYSA-N | | SMILES | C1(C)=NC=CC=C1C(OC)=O | | CAS DataBase Reference | 65719-09-7(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | Methyl 2-methylnicotinate Usage And Synthesis |
| Chemical Properties | Light Brown Oil | | Uses | Methyl 2-Methylnicotinate is an ester derivative of nicotinic acid used in the preparation of bicyclic nitrogen containing heterocycles. Methyl 2-Methylnicotinate is a pyrolysis product of cocaine. |
| | Methyl 2-methylnicotinate Preparation Products And Raw materials |
|