|
|
| | N-Cyanoethyl-hydroxyethyl aniline Basic information |
| | N-Cyanoethyl-hydroxyethyl aniline Chemical Properties |
| Melting point | 68 °C | | Boiling point | 315 °C(lit.) | | density | 1.06 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.57(lit.) | | Fp | 107-110°C/15mm | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.51±0.10(Predicted) | | form | clear liquid | | color | Colorless to Yellow to Green | | Water Solubility | Not miscible or difficult to mix with water. | | BRN | 2369849 | | InChI | InChI=1S/C11H14N2O/c12-7-4-8-13(9-10-14)11-5-2-1-3-6-11/h1-3,5-6,14H,4,8-10H2 | | InChIKey | WZJJWQVBLSPALW-UHFFFAOYSA-N | | SMILES | N(C1C=CC=CC=1)(CCO)CCC#N | | CAS DataBase Reference | 92-64-8(CAS DataBase Reference) | | EPA Substance Registry System | Propanenitrile, 3-[(2-hydroxyethyl)phenylamino]- (92-64-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | UG2905000 | | TSCA | TSCA listed | | HS Code | 29269090 |
| | N-Cyanoethyl-hydroxyethyl aniline Usage And Synthesis |
| Uses | N-(2-Cyanoethyl)-N-(2-hydroxyethyl)aniline is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff fields. |
| | N-Cyanoethyl-hydroxyethyl aniline Preparation Products And Raw materials |
|