| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
Ethoxylated Bisphenol A manufacturers
|
| | Ethoxylated Bisphenol A Basic information |
| | Ethoxylated Bisphenol A Chemical Properties |
| Boiling point | 350℃[at 101 325 Pa] | | density | 1.18 g/mL at 25 °C | | vapor pressure | 0Pa at 25℃ | | refractive index | n20/D 1.552 | | Fp | >230 °F | | form | viscous liquid | | Water Solubility | 697mg/L at 20℃ | | InChI | 1S/C15H16O2.C2H6O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12;3-1-2-4/h3-10,16-17H,1-2H3;3-4H,1-2H2 | | InChIKey | PFZPRMFEGRUXTO-UHFFFAOYSA-N | | SMILES | OCCO.CC(C)(c1ccc(O)cc1)c2ccc(O)cc2 | | LogP | 2.77 at 30℃ | | EPA Substance Registry System | Polyethylene glycol, diether with bisphenol A (2:1) (32492-61-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Ethoxylated Bisphenol A Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | Ethoxylated Bisphenol A Preparation Products And Raw materials |
|