| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
3-Chloro-4-fluoro-5-nitrobenzotrifluoride manufacturers
|
| | 3-Chloro-4-fluoro-5-nitrobenzotrifluoride Basic information |
| | 3-Chloro-4-fluoro-5-nitrobenzotrifluoride Chemical Properties |
| Boiling point | 200 °C (lit.) | | density | 1.607 g/mL at 25 °C (lit.) | | refractive index | 1.482 | | Fp | 113 °C | | storage temp. | Sealed in dry,Room Temperature | | form | liquid | | color | Clear | | BRN | 5436538 | | InChI | 1S/C7H2ClF4NO2/c8-4-1-3(7(10,11)12)2-5(6(4)9)13(14)15/h1-2H | | InChIKey | JVOKKJHIEVEFEB-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cc(cc(Cl)c1F)C(F)(F)F | | CAS DataBase Reference | 101646-02-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 36/37/39-45-36-26 | | RIDADR | 2306 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2904990090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | 3-Chloro-4-fluoro-5-nitrobenzotrifluoride Usage And Synthesis |
| Uses | 3-Chloro-4-fluoro-5-nitrobenzotrifluoride can be used as pyrolyl-tRNA synthetase inhibitors. It can also be used to treat various diseases, including nervous and mental disorders and inflammatory diseases, caused by abnormal intracellular signaling, that can include acetylcholine. |
| | 3-Chloro-4-fluoro-5-nitrobenzotrifluoride Preparation Products And Raw materials |
|