| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-(Toluene-4-sulfonylamino)phenylboronic acid, pinacol ester Basic information |
| Product Name: | 2-(Toluene-4-sulfonylamino)phenylboronic acid, pinacol ester | | Synonyms: | N-[2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PHENYL]-P-TOLUENESULFONAMIDE;2-(p-Toluenesulfonylamino)benzeneboronic acid pinacol ester, 97%;2-(P-TOLUENESULFONYLAMINO)PHENYLBORONIC ACID PINACOL ESTER;4-methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]benzenesulfonamide;Benzenesulfonamide, 4-methyl-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-;2-(p-Toluenesulfonylamino)phenylboronic acid pinacol ester;2-(p-Toluenesulfonylamino)benzeneboronic acid pinacol ester;2-(Toluene-4-sulfonylamino)phenylboronic acid, pinacol ester | | CAS: | 796061-07-9 | | MF: | C19H24BNO4S | | MW: | 373.27 | | EINECS: | | | Product Categories: | | | Mol File: | 796061-07-9.mol |  |
| | 2-(Toluene-4-sulfonylamino)phenylboronic acid, pinacol ester Chemical Properties |
| Melting point | 135-139°C | | Boiling point | 505.0±60.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | pka | 8.45±0.10(Predicted) | | form | solid | | InChI | 1S/C19H24BNO4S/c1-14-10-12-15(13-11-14)26(22,23)21-17-9-7-6-8-16(17)20-24-18(2,3)19(4,5)25-20/h6-13,21H,1-5H3 | | InChIKey | XJERZPFENBAXMZ-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)Nc2ccccc2B3OC(C)(C)C(C)(C)O3 |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(Toluene-4-sulfonylamino)phenylboronic acid, pinacol ester Usage And Synthesis |
| | 2-(Toluene-4-sulfonylamino)phenylboronic acid, pinacol ester Preparation Products And Raw materials |
|