| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Bis(4-trifluoromethylphenyl)phosphine Basic information |
| Product Name: | Bis(4-trifluoromethylphenyl)phosphine | | Synonyms: | potassium bis(4-(trifluoromethyl)phenyl)phosphide;DI-(4-TRIFLUOROMETHYLPHENYL)PHOSPHINE;Bis(4-trifluoromethylphenyl)phosphine,98%;Bis(4-trifluoromethylphenyl)phosphine 97%;Phosphine, bis[4-(trifluoromethyl)phenyl]-;Bis(4-trifluoromethylphenyl)phosphine | | CAS: | 99665-68-6 | | MF: | C14H9F6P | | MW: | 322.19 | | EINECS: | | | Product Categories: | | | Mol File: | 99665-68-6.mol |  |
| | Bis(4-trifluoromethylphenyl)phosphine Chemical Properties |
| Boiling point | 291.4±40.0 °C(Predicted) | | density | 1.317 g/mL at 25 °C | | refractive index | n20/D1.512 | | form | liquid | | InChI | 1S/C14H9F6P/c15-13(16,17)9-1-5-11(6-2-9)21-12-7-3-10(4-8-12)14(18,19)20/h1-8,21H | | InChIKey | LLJITAAISCMRAR-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1ccc(Pc2ccc(cc2)C(F)(F)F)cc1 |
| Hazard Codes | T | | Risk Statements | 25-37-41 | | Safety Statements | 26-39-45 | | RIDADR | UN 2810 6.1 / PGIII | | WGK Germany | WGK 3 | | Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Chronic 4
Eye Dam. 1 |
| | Bis(4-trifluoromethylphenyl)phosphine Usage And Synthesis |
| Uses | Reactant for:
- Preparation of iron(II) chiral diimine diphosphine complexes as catalysts for asymmetric transfer hydrogenation of ketones
- Enantioselective decarboxylative allylation and ring-closing metathesis
| | reaction suitability | reagent type: ligand |
| | Bis(4-trifluoromethylphenyl)phosphine Preparation Products And Raw materials |
|