| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:H-ALA-BETANA
CAS:720-82-1
|
|
| | H-ALA-BETANA Basic information |
| | H-ALA-BETANA Chemical Properties |
| Boiling point | 450.1±28.0 °C(Predicted) | | density | 1.209±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | ethanol: 50mg/mL, clear to slightly hazy | | pka | 14.13±0.30(Predicted) | | form | powder | | InChI | 1S/C13H14N2O/c1-9(14)13(16)15-12-7-6-10-4-2-3-5-11(10)8-12/h2-9H,14H2,1H3,(H,15,16)/t9-/m0/s1 | | InChIKey | RQHPADKWNYTHOH-VIFPVBQESA-N | | SMILES | C[C@H](N)C(=O)Nc1ccc2ccccc2c1 | | CAS DataBase Reference | 720-82-1(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | H-ALA-BETANA Usage And Synthesis |
| Uses | L-Alanine Ǧ-naphthylamide has been used to determine the activity of alanine aminopeptidase (AAP) in blood samples. It may be used as a fluorescent substrate to assay neutral aminopeptidase (APN) activity in cultured human and mouse chondrocytes. | | Definition | ChEBI: An L-alanine derivative that is the amide obtained by formal condensation of the carboxy group of L-alanine with the amino group of 2-naphthylamine. |
| | H-ALA-BETANA Preparation Products And Raw materials |
|