|
|
| | Glycinamide hydrochloride Basic information |
| | Glycinamide hydrochloride Chemical Properties |
| Melting point | 204 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | H2O: 0.1 g/mL, clear | | form | Crystalline Powder | | color | White to beige | | pka | 8.20(at 20℃) | | Water Solubility | Soluble in water (1100g/L). | | Sensitive | Hygroscopic | | λmax | λ: 260 nm Amax: 0.1 | | BRN | 3554199 | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | SKIN PROTECTING SKIN CONDITIONING | | InChI | InChI=1S/C2H6N2O.ClH/c3-1-2(4)5;/h1,3H2,(H2,4,5);1H | | InChIKey | WKNMKGVLOWGGOU-UHFFFAOYSA-N | | SMILES | C(=O)(N)CN.Cl | | CAS DataBase Reference | 1668-10-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-37/39-26 | | WGK Germany | 3 | | F | 3-10 | | HazardClass | IRRITANT | | HS Code | 29241900 | | Storage Class | 11 - Combustible Solids |
| | Glycinamide hydrochloride Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | Glycinamide hydrochloride is a buffer that is useful in the physiological pH range. And it is also used as a pharmaceutical intermediate, in the organic synthesis. | | Uses | Glycinamide hydrochloride may be used in the synthesis of [M(glycinamidato-N,N′)(ptpy)2] where ptpy = 2-(p-tolyl)pyridinato) and M= Rh or Ir. It may be used in the synthesis of the following glycinamide-based imidazolidinones:
- (±)-2-(2-phenylpropyl)imidazolidin-4-one
- (±)-2-(2,4,4-trimethylpentyl)imidazolidin-4-one
- (±)-2-[(R)-2,6-dimethyl-5-heptenyl]imidazolidin-4-one
- (5R,6S,9R)-6-isopropyl-9-methyl-1,4-diazaspiro[4.5]decan-2-one
- (5S,6S,9R)-6-isopropyl-9-methyl-1,4-diazaspiro[4.5]decan-2-one
- (±)-2-methyl-2-pentylimidazolidin-4-one
- (±)-2-ethyl-2-(2-methylbutyl)imidazolidin-4-one
- (±)-2-(undecan-2-yl)imidazolidin-4-one
- (±)-2-pentylimidazolidin-4-one
- 2-(2,4-dimethylcyclohex-3-en-1-yl)imidazolidin-4-one
| | Purification Methods | Crystallise the salt from EtOH, EtOH/H2O or MeOH. [Karmas & Spoerri J Am Chem Soc 74 1580 1952, Beilstein 4 IV 2358.] |
| | Glycinamide hydrochloride Preparation Products And Raw materials |
|