|
|
| | (+/-)-NORPROPOXYPHENE-D5 MALEATE Basic information |
| Product Name: | (+/-)-NORPROPOXYPHENE-D5 MALEATE | | Synonyms: | (+/-)-NORPROPOXYPHENE-D5 MALEATE;Benzeneethanol, .alpha.-1-methyl-2-(methylamino)ethyl-.alpha.-(phenyl-d5)-, propanoate (ester), (2Z)-2-butenedioate (1:1) (salt);(±)-Norpropoxyphene-d5 maleate solution;[3-methyl-4-(methylamino)-2-(2,3,4,5,6-pentadeuteriophenyl)-1-phenylbutan-2-yl] propanoate;Nor Propoxyphene-D5 Maleate Salt;d,l-Norpropoxyphene-D5.maleate | | CAS: | 136765-47-4 | | MF: | C25H26D5NO6 | | MW: | 446.55 | | EINECS: | 200-659-6 | | Product Categories: | | | Mol File: | 136765-47-4.mol |  |
| | (+/-)-NORPROPOXYPHENE-D5 MALEATE Chemical Properties |
| Fp | 9℃ | | storage temp. | 2-8°C | | form | liquid | | Major Application | forensics and toxicology | | InChIKey | HCQPFYNZJNOOKN-ZXYHGPIJSA-N | | SMILES | OC(=O)\C=C/C(O)=O.[2H]c1c([2H])c([2H])c(c([2H])c1[2H])C(Cc2ccccc2)(OC(=O)CC)C(C)CNC |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | (+/-)-NORPROPOXYPHENE-D5 MALEATE Usage And Synthesis |
| Uses | Nor Propoxyphene-D5 Maleate Salt is a labelled compound form of Nor Propoxyphene Maleate Salt(N825700) which is the analgetic metabolite of Propoxyphene (P831500), which is a controlled substance (opiate). Analgesic (narcotic). The α-dl-and d-diastereoisomers possess marked analgesic activity in contrast to the β-diastereoisomers which are substantially inactive. |
| | (+/-)-NORPROPOXYPHENE-D5 MALEATE Preparation Products And Raw materials |
|