| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine Basic information |
| Product Name: | (R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine | | Synonyms: | (R)-(1,2,3,4-TETRAHYDRO-NAPHTHALEN-1-YL)AMINE;(R)-(-)-1-AMINOTETRALIN;(R)-(+)-1-AMINOTETRALIN;(R)-1-AMINOTETRALIN;(R)-(-)-1-AMINOTETRALINE;(R)-1-Amino-1,2,3,4-tetrahydronaphthalene;(r)-(-)-1-aminotetralin tm;(R)-(-)-1,2,3,4-TETRAHYDRO-1-NAPHTHYLAMINE: CHIPROS 99%, EE 98% | | CAS: | 23357-46-2 | | MF: | C10H13N | | MW: | 147.22 | | EINECS: | 628-771-4 | | Product Categories: | Tetrazoles | | Mol File: | 23357-46-2.mol |  |
| | (R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine Chemical Properties |
| Melting point | 116-119 °C | | Boiling point | 118-120 °C/10 mbar | | density | 1.002 g/mL at 25 °C | | refractive index | 1.565 | | Fp | >110°C | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | clear liquid | | pka | 9.39±0.20(Predicted) | | color | Colorless to Light yellow to Light orange | | Water Solubility | Soluble in water (6.91g/L at 25°C). | | Sensitive | Air Sensitive | | BRN | 4231302 | | InChI | InChI=1S/C10H13N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10H,3,5,7,11H2/t10-/m1/s1 | | InChIKey | JRZGPXSSNPTNMA-SNVBAGLBSA-N | | SMILES | [C@H]1(N)C2=C(C=CC=C2)CCC1 | | CAS DataBase Reference | 23357-46-2(CAS DataBase Reference) |
| Hazard Codes | Xi,N,C | | Risk Statements | 36/37-51/53-36/37/38-52/53-34-22 | | Safety Statements | 26-36/37/39-61-45 | | RIDADR | UN 3082 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | Ⅲ | | HS Code | 2921450090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Skin Corr. 1C |
| Provider | Language |
|
ALFA
| English |
| | (R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine Usage And Synthesis |
| Uses | (R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. Chiral amines play an important role in stereoselective organic synthesis. They are used directly as resolving agents, building blocks or chiral auxiliaries. | | Synthesis | (R)-1-Amino-1,2,3,4-tetrahydronaphthalene is a contactor that can be synthesized by the reaction of an enantiomerically pure amine with a primary oxidant. |
| | (R)-(-)-1,2,3,4-Tetrahydro-1-naphthylamine Preparation Products And Raw materials |
|