|
|
| | Methyl 3,5-diamino-6-chloropyrazine-2-carboxylate Basic information |
| | Methyl 3,5-diamino-6-chloropyrazine-2-carboxylate Chemical Properties |
| Melting point | 211-215 °C (lit.) | | Boiling point | 449.9±40.0 °C(Predicted) | | density | 1.555±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | solid | | pka | -0.10±0.10(Predicted) | | color | Light Brown to Brown | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/C6H7ClN4O2/c1-13-6(12)2-4(8)11-5(9)3(7)10-2/h1H3,(H4,8,9,11) | | InChIKey | KOOBYHRLTYIPTH-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=NC(Cl)=C(N)N=C1N | | CAS DataBase Reference | 1458-01-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | HS Code | 2933997500 | | Storage Class | 11 - Combustible Solids |
| | Methyl 3,5-diamino-6-chloropyrazine-2-carboxylate Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | Amiloride USP Related Compound A |
| | Methyl 3,5-diamino-6-chloropyrazine-2-carboxylate Preparation Products And Raw materials |
|