| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | Boc-Tyr(PO3Me2)-OH Basic information |
| Product Name: | Boc-Tyr(PO3Me2)-OH | | Synonyms: | BOC-TYROSINE(PO3ME2)-OH;Boc-L-Tyr(PO3Me2)-OH;Boc-O-dimethylphospho-L-tyrosine≥ 98% (HPLC);N-ALPHA-T-BUTOXYCARBONYL-O-DIMETHYLPHOSPHONO-L-TYROSINE;N-ALPHA-T-BUTOXYCARBONYL-O-DIMETHYLPHOSPHENO-L-TYROSINE;nα-boc-o-(dimethylphospho)-l-tyrosine;BOC-O-DIMETHYLPHOSPHO-L-TYROSINE;Boc-Tyr(PO3Me2)-OH >=96.0% (HPLC) | | CAS: | 92264-99-8 | | MF: | C16H24NO8P | | MW: | 389.34 | | EINECS: | | | Product Categories: | | | Mol File: | 92264-99-8.mol |  |
| | Boc-Tyr(PO3Me2)-OH Chemical Properties |
| Boiling point | 505.4±50.0 °C(Predicted) | | density | 1.272±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.91±0.10(Predicted) | | form | solid | | color | white | | BRN | 3632773 | | Major Application | peptide synthesis | | InChI | 1S/C16H24NO8P/c1-16(2,3)24-15(20)17-13(14(18)19)10-11-6-8-12(9-7-11)25-26(21,22-4)23-5/h6-9,13H,10H2,1-5H3,(H,17,20)(H,18,19)/t13-/m0/s1 | | InChIKey | SPVKDJVZEGSJSS-ZDUSSCGKSA-N | | SMILES | COP(=O)(OC)Oc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(O)=O)cc1 |
| WGK Germany | 3 | | F | 1-10 | | Storage Class | 13 - Non Combustible Solids |
| | Boc-Tyr(PO3Me2)-OH Usage And Synthesis |
| Chemical Properties | Yellow, viscous oil | | Uses | peptide synthesis |
| | Boc-Tyr(PO3Me2)-OH Preparation Products And Raw materials |
|