| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- 2-naphthylacetonitrile
-
- $10.00
-
2021-10-11
- CAS:7498-57-9
- Min. Order: 1Kg/Bag
- Purity: 99%
- Supply Ability: 20 tons
- 2-Naphthylacetonitrile
-
- $1.00
-
2020-01-10
- CAS:7498-57-9
- Min. Order: 1KG
- Purity: 98% HPLC
- Supply Ability: 10 tons/month
|
| | 2-Naphthylacetonitrile Basic information |
| | 2-Naphthylacetonitrile Chemical Properties |
| Melting point | 82-84 °C (lit.) | | Boiling point | 303 °C (lit.) | | density | 1.092 g/mL at 25 °C (lit.) | | refractive index | 1.5785 (estimate) | | Fp | 303°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | Water Solubility | Insoluble in water. | | BRN | 1862879 | | InChI | InChI=1S/C12H9N/c13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-6,9H,7H2 | | InChIKey | LPCWDVLDJVZIHA-UHFFFAOYSA-N | | SMILES | C1=C2C(C=CC=C2)=CC=C1CC#N | | CAS DataBase Reference | 7498-57-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Naphthylacetonitrile(7498-57-9) |
| Hazard Codes | Xn,C,F | | Risk Statements | 20/21/22-34-11 | | Safety Statements | 36-24/25-45-36/37/39-26-16 | | RIDADR | 3276 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
| | 2-Naphthylacetonitrile Usage And Synthesis |
| Chemical Properties | white to light yellow powder | | Uses | 2-Naphthylacetonitrile was used as starting reagent in the synthesis of 2-(1-cyano-1-(2-naphthyl))methylidene-3-phenyl-thiazolidine-4,5-dione. | | Synthesis Reference(s) | Synthetic Communications, 23, p. 1061, 1993 DOI: 10.1080/00397919308018582 | | General Description | 2-Naphthylacetonitrile undergoes three-component coupling with benzyne and DMF to yield coumarins. |
| | 2-Naphthylacetonitrile Preparation Products And Raw materials |
|