| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1-Naphthylacetonitrile Basic information |
| | 1-Naphthylacetonitrile Chemical Properties |
| Melting point | 33-35 °C(lit.) | | Boiling point | 191-194 °C18 mm Hg(lit.) | | density | 1.1110 (rough estimate) | | refractive index | n20/D 1.6192(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly), Dichloromethane (Slightly), Methanol (Slightly) | | form | Liquid After Melting | | color | Clear yellow to brown | | BRN | 1101012 | | InChI | InChI=1S/C12H9N/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8H2 | | InChIKey | OQRMWUNUKVUHQO-UHFFFAOYSA-N | | SMILES | C1(CC#N)=C2C(C=CC=C2)=CC=C1 | | CAS DataBase Reference | 132-75-2(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Naphthaleneacetonitrile(132-75-2) | | EPA Substance Registry System | 1-Naphthaleneacetonitrile (132-75-2) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-22 | | Safety Statements | 26-37/39-24/25-37-36 | | RIDADR | 3276 | | WGK Germany | 3 | | RTECS | AM1240000 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Toxicity | mouse,LD50,intravenous,180mg/kg (180mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#03835, |
| | 1-Naphthylacetonitrile Usage And Synthesis |
| Chemical Properties | White to yellow solid or melt. Insoluble in water. | | Uses | 2-(Naphthalen-1-yl)acetonitrile is useful for the preparation of tert-Bu benzoates. | | Preparation | Synthesis of 1-naphthylacetonitrile: 695g of 1-chloromethyl naphthalene, 1500ml of methanol and 475ml of water, 350g of sodium cyanide mixture boiling reflux, stirring the reaction for 2h. 1300ml of methanol was evaporated, cooled, and the reactants were washed with water to neutral to obtain 670-680g of 1-naphthylacetonitrile. | | Application | 1-Naphthylacetonitrile is an organic synthesis intermediate. It is used in the synthesis of 1-naphthylacetate. | | Synthesis Reference(s) | Chemical and Pharmaceutical Bulletin, 39, p. 3030, 1991 DOI: 10.1248/cpb.39.3030 |
| | 1-Naphthylacetonitrile Preparation Products And Raw materials |
|