| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
4-Methyl-2-nitrophenyl isocyanate manufacturers
|
| | 4-Methyl-2-nitrophenyl isocyanate Basic information |
| | 4-Methyl-2-nitrophenyl isocyanate Chemical Properties |
| Melting point | 57-61 °C(lit.) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | crystalline powder | | color | Gold/tan | | Sensitive | Moisture Sensitive | | BRN | 3267117 | | InChI | 1S/C8H6N2O3/c1-6-2-3-7(9-5-11)8(4-6)10(12)13/h2-4H,1H3 | | InChIKey | RTXDHIPQKZLDJD-UHFFFAOYSA-N | | SMILES | Cc1ccc(N=C=O)c(c1)[N+]([O-])=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 22-26-36 | | RIDADR | 2811 | | WGK Germany | 3 | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29291090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 4-Methyl-2-nitrophenyl isocyanate Usage And Synthesis |
| Uses | 4-Methyl-2-nitrophenyl isocyanate may be used in the preparation 4-methylphenyl analog of 2-[(2-nitrophenyl)amino]furanone. | | General Description | 4-Methyl-2-nitrophenyl isocyanate, also known as 1-isocyanato-4-methyl-2-nitrobenzene, is an organic building block containing an isocyanate group. The conformational analysis of 4-methyl-2-nitrophenyl isocyanate has been reported based on its vibrational spectral data and density functional theory (DFT) calculations. |
| | 4-Methyl-2-nitrophenyl isocyanate Preparation Products And Raw materials |
|