2-NITROPHENYL ISOCYANATE manufacturers
- 2-NITROPHENYL ISOCYANATE
-
- $9.80 / 1KG
-
2020-01-05
- CAS: 3320-86-3
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 1kg -1000kg
|
| | 2-NITROPHENYL ISOCYANATE Basic information |
| | 2-NITROPHENYL ISOCYANATE Chemical Properties |
| Melting point | 40-41 °C(lit.) | | Boiling point | 135-137 °C17 mm Hg(lit.) | | density | 1.5018 (rough estimate) | | refractive index | 1.5300 (estimate) | | Fp | >230 °F | | storage temp. | 2-8°C | | form | Crystalline Solid | | color | Yellow | | InChI | 1S/C7H4N2O3/c10-5-8-6-3-1-2-4-7(6)9(11)12/h1-4H | | InChIKey | JRVZITODZAQRQM-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccccc1N=C=O | | CAS DataBase Reference | 3320-86-3(CAS DataBase Reference) | | EPA Substance Registry System | Benzene, 1-isocyanato-2-nitro- (3320-86-3) |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-27-36/37/39 | | RIDADR | 2206 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29291090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 2-NITROPHENYL ISOCYANATE Usage And Synthesis |
| Chemical Properties | yellow crystalline solid | | Uses | 2-Nitrophenyl isocyanate was used in the synthesis of symmetrical bis-2-nitrophenylcarbodi-imide via dimerisation reaction. |
| | 2-NITROPHENYL ISOCYANATE Preparation Products And Raw materials |
|