| Company Name: |
NORANA GROUP Gold |
| Tel: |
027-59209883 17386138556 |
| Email: |
service@nornachem.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
2-Diethylaminoethanol hydrochloride manufacturers
|
| | 2-Diethylaminoethanol hydrochloride Basic information |
| | 2-Diethylaminoethanol hydrochloride Chemical Properties |
| Melting point | 133°C | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly), Water (Slightly) | | form | Solid | | color | Off-White | | Sensitive | Moisture Sensitive | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | InChI | InChI=1S/C6H15NO.ClH/c1-3-7(4-2)5-6-8;/h8H,3-6H2,1-2H3;1H | | InChIKey | DBQUKJMNGUJRFI-UHFFFAOYSA-N | | SMILES | N(CC)(CC)CCO.Cl | | CAS DataBase Reference | 14426-20-1(CAS DataBase Reference) | | EPA Substance Registry System | Ethanol, 2-(diethylamino)-, hydrochloride (14426-20-1) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RTECS | KK5553400 | | TSCA | TSCA listed | | Toxicity | mouse,LD50,intraperitoneal,1162mg/kg (1162mg/kg),Archiv der Pharmazie und Berichte der Deutschen Pharmazeutischen Gesellschaft. Vol. 290, Pg. 131, 1957. |
| Provider | Language |
|
ALFA
| English |
| | 2-Diethylaminoethanol hydrochloride Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 2-Diethylaminoethanol Hydrochloride (cas# 14426-20-1) is a compound useful in organic synthesis. |
| | 2-Diethylaminoethanol hydrochloride Preparation Products And Raw materials |
|