- 3-Bromocinnamic acid
-
-
2026-08-21
- CAS:32862-97-8
- Min. Order: 100gm
- Purity: 99%min
- Supply Ability: 100kgs
- 3-Bromocinnamic acid
-
- $1.00
-
2020-02-04
- CAS:32862-97-8
- Min. Order: 1KG
- Purity: 98-99.9%
- Supply Ability: 100kg
- 3-Bromocinnamic acid
-
- $8.80
-
2019-07-14
- CAS: 32862-97-8
- Min. Order: 1KG
- Purity: 97%-99%
- Supply Ability: 100kg
|
| | 3-Bromocinnamic acid Basic information |
| | 3-Bromocinnamic acid Chemical Properties |
| Melting point | 177-179 °C(lit.) | | Boiling point | 344.1±25.0 °C(Predicted) | | density | 1.5403 (rough estimate) | | refractive index | 1.5627 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | methanol: soluble | | form | Crystalline Powder | | pka | 4.27±0.10(Predicted) | | color | White to light yellow | | InChI | InChI=1S/C9H7BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6H,(H,11,12) | | InChIKey | YEMUSDCFQUBPAL-SNAWJCMRSA-N | | SMILES | C(O)(=O)C=CC1=CC=CC(Br)=C1 | | CAS DataBase Reference | 32862-97-8(CAS DataBase Reference) | | NIST Chemistry Reference | 3-Bromocinnamic acid(32862-97-8) | | EPA Substance Registry System | m-Bromocinnamic acid (32862-97-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | GD8420000 | | TSCA | TSCA listed | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3-Bromocinnamic acid Usage And Synthesis |
| Description | 3-Bromocinnamic acid (also known as m-Bromocinnamic acid, 3-(3-Bromophenyl)-2-propenoic acid) is the primary active metabolite of the anticonvulsant drug cinromide (3-bromo-N-ethylcinnamamide). In vivo studies suggest that 3-Bromocinnamic acid may possess certain anticonvulsant properties and is primarily used in clinical testing and research related to cinromide. | | Chemical Properties | white to light yellow crystal powder | | Uses | 3-Bromocinnamic acid is an organic synthesis intermediate. | | Preparation | synthesis of 3-bromocinnamic acid from an aryl iodide (3 bromoiodobenzene) and acrylic acid. | | General Description | 3-Bromocinnamic acid is the metabolite of cinromide (3-bromo-N-ethylcinnamamide) and can be analysed in plasma by high-performance liquid chromatographic method. |
| | 3-Bromocinnamic acid Preparation Products And Raw materials |
|