- 4-Bromocinnamic Acid
-
- $10.00
-
2026-05-28
- CAS:1200-07-3
- Min. Order: 1KG
- Purity: 99.8%
- Supply Ability: 100tons
- 4-Bromocinnamic acid
-
- $1.00
-
2026-03-20
- CAS:1200-07-3
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10 mt
|
| | 4-Bromocinnamic acid Basic information |
| | 4-Bromocinnamic acid Chemical Properties |
| Melting point | 260-265 °C | | Boiling point | 344.9±17.0 °C(Predicted) | | density | 1.607±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO | | pka | 4.35±0.10(Predicted) | | form | Solid | | color | Whie | | Water Solubility | Soluble in alcohol, ethyl acetate, DMSO. Insoluble in water. | | BRN | 3538823 | | InChI | InChI=1S/C9H7BrO2/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H,11,12) | | InChIKey | CPDDDTNAMBSPRN-UHFFFAOYSA-N | | SMILES | C(O)(=O)C=CC1=CC=C(Br)C=C1 | | CAS DataBase Reference | 1200-07-3(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 36/37/38-22 | | Safety Statements | 36/37/39-26-22 | | WGK Germany | 3 | | RTECS | UD3110000 | | Hazard Note | Irritant | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 | | Toxicity | mouse,LD,intraperitoneal,> 250mg/kg (250mg/kg),BEHAVIORAL: CHANGES IN MOTOR ACTIVITY (SPECIFIC ASSAY)BEHAVIORAL: REGIDITYBEHAVIORAL: ATAXIA,Indian Journal of Pharmaceutical Sciences. Vol. 49, Pg. 77, 1987. |
| | 4-Bromocinnamic acid Usage And Synthesis |
| Chemical Properties | Whie Solid | | Uses | 4-Bromocinnamic acid has been used in the preparation of: (E)-β-bromo-4-bromostyrene, 2-amino-7-(piperidin-4-yl)isoquinoline, brominated dansyl derivative (4-bromophenyl)-4-(5-(dimethylamino)naphthalene-1-sulfonamido)butanoic acid. |
| | 4-Bromocinnamic acid Preparation Products And Raw materials |
|