|
|
| | Brilliant Cresyl Blue Basic information |
| | Brilliant Cresyl Blue Chemical Properties |
| Melting point | 233-236 °C(lit.) | | Boiling point | 78 °C | | density | 0.808 | | Fp | 15 °C | | storage temp. | Store at +15°C to +30°C. | | solubility | DMSO (Slghtly), Ethanol (Slightly), Water (Slightly) | | Colour Index | 51010 | | form | Crystalline Powder | | pka | 6.0, 11.0(at 25℃) | | color | White to off-white | | Odor | Odorless | | PH Range | 3.7 at 20°C | | BRN | 5690713 | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | InChI=1S/C17H21N4O.4ClH.Zn/c1-4-21(5-2)11-6-7-14-15(8-11)22-17-10(3)12(18)9-13(19)16(17)20-14;;;;;/h6-9H,4-5,18-19H2,1-3H3;4*1H;/q+1;;;;;+2/p-4 | | InChIKey | MJQMEHNJPRMZLG-UHFFFAOYSA-J | | SMILES | [Zn+2]([Cl-])([Cl-])([Cl-])[Cl-].NC1=CC(N)=C(C)C2=[O+]C3=CC(N(CC)CC)=CC=C3N=C12 |
| | Brilliant Cresyl Blue Usage And Synthesis |
| Chemical Properties | deep green to dark blue crystalline powder | | Uses | Brilliant Cresyl blue is a useful electroactive indicator dye.Dyes and metabolites. |
| | Brilliant Cresyl Blue Preparation Products And Raw materials |
|