| Company Name: |
Entegris, Inc. Gold |
| Tel: |
021-52980362 18121213678 |
| Email: |
jenny.ji@entegris.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Allyl tetraisopropylphosphorodiamidite Basic information |
| Product Name: | Allyl tetraisopropylphosphorodiamidite | | Synonyms: | Allyl tetraisopropylphosphorodiamidite 95%;Phosphorodiamidousacid, N,N,N',N'-tetrakis(1-methylethyl)-, 2-propen-1-yl ester;allyl N,N,N',N'-tetraisopropylphosphorodiamidite;N-[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]-N-propan-2-ylpropan-2-amine;1-(allyloxy)-N,N,N',N'-tetraisopropylphosphinediamine;1-(allyloxy)-N,N,N',N'-tetraisopropylphosphanediamine;(allyloxy)bis(diisopropylamino)phosphine;Allyl tetraisopropylphosphorodiamidite | | CAS: | 108554-72-9 | | MF: | C15H33N2OP | | MW: | 288.41 | | EINECS: | | | Product Categories: | | | Mol File: | 108554-72-9.mol |  |
| | Allyl tetraisopropylphosphorodiamidite Chemical Properties |
| Boiling point | 114-117 °C/0.4 mmHg(lit.) | | density | 0.903 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.466(lit.) | | Fp | 113 °C | | storage temp. | 2-8°C | | pka | 7.71±0.70(Predicted) | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C15H33N2OP/c1-10-11-18-19(16(12(2)3)13(4)5)17(14(6)7)15(8)9/h10,12-15H,1,11H2,2-9H3 | | InChIKey | ZTEGHJIXOZLSOH-UHFFFAOYSA-N | | SMILES | P(N(C(C)C)C(C)C)(N(C(C)C)C(C)C)OCC=C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 2931499090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Allyl tetraisopropylphosphorodiamidite Usage And Synthesis |
| Uses | Allyl tetraisopropylphosphorodiamidite may be used in the total synthesis of ()-tetrahydrolipstatin, dolabelide C, (-)-salicylihalamides A and B. |
| | Allyl tetraisopropylphosphorodiamidite Preparation Products And Raw materials |
|