|
|
| | 3-Methyl-N-butylpyridinium chloride Basic information |
| Product Name: | 3-Methyl-N-butylpyridinium chloride | | Synonyms: | N-BUTYL-3-METHYLPYRIDINIUM CHLORIDE;1-Butyl-3-methylpyridinium Chloride;N-butyl-3-metylpyridinium chloride;B3MePyCl;1-butyl-3-methylpyridin-1-ium,chloride;[C4MPy]Cl;1-Butyl-3-methylpyridiniumChloride>;Pyridinium, 1-butyl-3-methyl-, chloride (1:1) | | CAS: | 125652-55-3 | | MF: | C10H16ClN | | MW: | 185.69 | | EINECS: | 679-563-5 | | Product Categories: | | | Mol File: | 125652-55-3.mol |  |
| | 3-Methyl-N-butylpyridinium chloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | color | White to Light yellow to Dark green | | InChI | InChI=1S/C10H16N.ClH/c1-3-4-7-11-8-5-6-10(2)9-11;/h5-6,8-9H,3-4,7H2,1-2H3;1H/q+1;/p-1 | | InChIKey | PHCASOSWUQOQAG-UHFFFAOYSA-M | | SMILES | [N+]1(CCCC)=CC=CC(C)=C1.[Cl-] | | CAS DataBase Reference | 125652-55-3 |
| | 3-Methyl-N-butylpyridinium chloride Usage And Synthesis |
| Uses |
3-Methyl-N-Butylpyridinium Chloride is used as an Ionic liquid, it can dissolve large amounts of cellulose at considerably mild conditions.1
| | References |
[1]Dadi, A.P., Varanasi, S. and Schall, C.A. (2006), Enhancement of cellulose saccharification kinetics using an ionic liquid pretreatment step. Biotechnol. Bioeng., 95: 904-910. https://doi.org/10.1002/bit.21047
|
| | 3-Methyl-N-butylpyridinium chloride Preparation Products And Raw materials |
|